C17H18INO4S2 — CID 43030993
N-(1,1-dioxothiolan-3-yl)-2-(3-iodophenoxy)-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 43030993) has the molecular formula C17H18INO4S2 and a molecular weight of 491.37 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(3-iodophenoxy)-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(3-iodophenoxy)-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 43030993 |
| Molecular Formula | C17H18INO4S2 |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 490.97 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(3-iodophenoxy)-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(COc1cccc(I)c1)N(Cc1cccs1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H18INO4S2/c18-13-3-1-4-15(9-13)23-11-17(20)19(10-16-5-2-7-24-16)14-6-8-25(21,22)12-14/h1-5,7,9,14H,6,8,10-12H2 |
| InChIKey | DEEQJPXZVDAZDE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|