C17H17FN2O6S2 — CID 46821326
N-(1,1-dioxothiolan-3-yl)-2-(5-fluoro-2-nitrophenoxy)-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 46821326) has the molecular formula C17H17FN2O6S2 and a molecular weight of 428.46 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(5-fluoro-2-nitrophenoxy)-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(5-fluoro-2-nitrophenoxy)-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 46821326 |
| Molecular Formula | C17H17FN2O6S2 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(5-fluoro-2-nitrophenoxy)-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(COc1cc(F)ccc1[N+](=O)[O-])N(Cc1cccs1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H17FN2O6S2/c18-12-3-4-15(20(22)23)16(8-12)26-10-17(21)19(9-14-2-1-6-27-14)13-5-7-28(24,25)11-13/h1-4,6,8,13H,5,7,9-11H2 |
| InChIKey | VQIQRBXAUBEWMQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|