C13H15FN2O6S — CID 2638344
N-[(3R)-1,1-dioxothiolan-3-yl]-2-(5-fluoro-2-nitrophenoxy)-N-methylacetamide (PubChem CID 2638344) has the molecular formula C13H15FN2O6S and a molecular weight of 346.34 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-2-(5-fluoro-2-nitrophenoxy)-N-methylacetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-(5-fluoro-2-nitrophenoxy)-N-methylacetamide |
|---|---|
| PubChem CID | 2638344 |
| Molecular Formula | C13H15FN2O6S |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-(5-fluoro-2-nitrophenoxy)-N-methylacetamide |
| SMILES | CN(C(=O)COc1cc(F)ccc1[N+](=O)[O-])[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15FN2O6S/c1-15(10-4-5-23(20,21)8-10)13(17)7-22-12-6-9(14)2-3-11(12)16(18)19/h2-3,6,10H,4-5,7-8H2,1H3/t10-/m1/s1 |
| InChIKey | SRASLXMWJGBQMM-SNVBAGLBSA-N |
| XLogP | 0.76 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|