C14H17FN2O6S — CID 6601102
N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethyl-2-(5-fluoro-2-nitrophenoxy)acetamide (PubChem CID 6601102) has the molecular formula C14H17FN2O6S and a molecular weight of 360.36 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethyl-2-(5-fluoro-2-nitrophenoxy)acetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethyl-2-(5-fluoro-2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 6601102 |
| Molecular Formula | C14H17FN2O6S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-ethyl-2-(5-fluoro-2-nitrophenoxy)acetamide |
| SMILES | CCN(C(=O)COc1cc(F)ccc1[N+](=O)[O-])[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H17FN2O6S/c1-2-16(11-5-6-24(21,22)9-11)14(18)8-23-13-7-10(15)3-4-12(13)17(19)20/h3-4,7,11H,2,5-6,8-9H2,1H3/t11-/m0/s1 |
| InChIKey | DSHJQNXPMVLIKJ-NSHDSACASA-N |
| XLogP | 1.15 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|