C22H26N2O6S — CID 3361975
N-(1,1-dioxothiolan-3-yl)-2-(2-nitrophenoxy)-N-[(4-propan-2-ylphenyl)methyl]acetamide (PubChem CID 3361975) has the molecular formula C22H26N2O6S and a molecular weight of 446.53 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(2-nitrophenoxy)-N-[(4-propan-2-ylphenyl)methyl]acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(2-nitrophenoxy)-N-[(4-propan-2-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 3361975 |
| Molecular Formula | C22H26N2O6S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(2-nitrophenoxy)-N-[(4-propan-2-ylphenyl)methyl]acetamide |
| SMILES | CC(C)c1ccc(CN(C(=O)COc2ccccc2[N+](=O)[O-])C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C22H26N2O6S/c1-16(2)18-9-7-17(8-10-18)13-23(19-11-12-31(28,29)15-19)22(25)14-30-21-6-4-3-5-20(21)24(26)27/h3-10,16,19H,11-15H2,1-2H3 |
| InChIKey | ZGSZDZJFKDBLBG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|