C21H23ClN2O5S — CID 41019642
4-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-3-nitro-N-[(4-propan-2-ylphenyl)methyl]benzamide (PubChem CID 41019642) has the molecular formula C21H23ClN2O5S and a molecular weight of 450.94 g/mol. Its IUPAC name is 4-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-3-nitro-N-[(4-propan-2-ylphenyl)methyl]benzamide.
| Compound Name | 4-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-3-nitro-N-[(4-propan-2-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 41019642 |
| Molecular Formula | C21H23ClN2O5S |
| Molecular Weight | 450.94 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 4-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-3-nitro-N-[(4-propan-2-ylphenyl)methyl]benzamide |
| SMILES | CC(C)c1ccc(CN(C(=O)c2ccc(Cl)c([N+](=O)[O-])c2)[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C21H23ClN2O5S/c1-14(2)16-5-3-15(4-6-16)12-23(18-9-10-30(28,29)13-18)21(25)17-7-8-19(22)20(11-17)24(26)27/h3-8,11,14,18H,9-10,12-13H2,1-2H3/t18-/m0/s1 |
| InChIKey | BQSVRYVFJVBFRJ-SFHVURJKSA-N |
| XLogP | 4.20 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.94 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|