C16H15ClN2O5S2 — CID 3366238
4-chloro-N-(1,1-dioxothiolan-3-yl)-3-nitro-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 3366238) has the molecular formula C16H15ClN2O5S2 and a molecular weight of 414.89 g/mol. Its IUPAC name is 4-chloro-N-(1,1-dioxothiolan-3-yl)-3-nitro-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 4-chloro-N-(1,1-dioxothiolan-3-yl)-3-nitro-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 3366238 |
| Molecular Formula | C16H15ClN2O5S2 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | 4-chloro-N-(1,1-dioxothiolan-3-yl)-3-nitro-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C(c1ccc(Cl)c([N+](=O)[O-])c1)N(Cc1cccs1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H15ClN2O5S2/c17-14-4-3-11(8-15(14)19(21)22)16(20)18(9-13-2-1-6-25-13)12-5-7-26(23,24)10-12/h1-4,6,8,12H,5,7,9-10H2 |
| InChIKey | DTKBKMYMJKVXOY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|