C16H16N2O5S2 — CID 7447531
N-[(3R)-1,1-dioxothiolan-3-yl]-4-nitro-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 7447531) has the molecular formula C16H16N2O5S2 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-4-nitro-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-4-nitro-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 7447531 |
| Molecular Formula | C16H16N2O5S2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-4-nitro-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N(Cc1cccs1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H16N2O5S2/c19-16(12-3-5-13(6-4-12)18(20)21)17(10-15-2-1-8-24-15)14-7-9-25(22,23)11-14/h1-6,8,14H,7,9-11H2/t14-/m1/s1 |
| InChIKey | KDQHERDIKQCBJO-CQSZACIVSA-N |
| XLogP | 2.49 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|