C18H19N3O8S2 — CID 55667363
methyl 1-[2-[(1,1-dioxothiolan-3-yl)-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate (PubChem CID 55667363) has the molecular formula C18H19N3O8S2 and a molecular weight of 469.50 g/mol. Its IUPAC name is methyl 1-[2-[(1,1-dioxothiolan-3-yl)-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate.
| Compound Name | methyl 1-[2-[(1,1-dioxothiolan-3-yl)-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 55667363 |
| Molecular Formula | C18H19N3O8S2 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | methyl 1-[2-[(1,1-dioxothiolan-3-yl)-(thiophen-2-ylmethyl)amino]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(=O)n(CC(=O)N(Cc2cccs2)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C18H19N3O8S2/c1-29-18(24)12-7-15(21(25)26)17(23)19(8-12)10-16(22)20(9-14-3-2-5-30-14)13-4-6-31(27,28)11-13/h2-3,5,7-8,13H,4,6,9-11H2,1H3 |
| InChIKey | BSRCZNGEVLBMEM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 145.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|