C17H17N3O6S — CID 47504798
methyl 1-[2-[cyclopropyl(thiophen-3-ylmethyl)amino]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate (PubChem CID 47504798) has the molecular formula C17H17N3O6S and a molecular weight of 391.41 g/mol. Its IUPAC name is methyl 1-[2-[cyclopropyl(thiophen-3-ylmethyl)amino]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate.
| Compound Name | methyl 1-[2-[cyclopropyl(thiophen-3-ylmethyl)amino]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 47504798 |
| Molecular Formula | C17H17N3O6S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | methyl 1-[2-[cyclopropyl(thiophen-3-ylmethyl)amino]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(=O)n(CC(=O)N(Cc2ccsc2)C2CC2)c1 |
| InChI | InChI=1S/C17H17N3O6S/c1-26-17(23)12-6-14(20(24)25)16(22)18(8-12)9-15(21)19(13-2-3-13)7-11-4-5-27-10-11/h4-6,8,10,13H,2-3,7,9H2,1H3 |
| InChIKey | OUMBUHFBXLOKOB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 111.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|