C19H22N4O8S — CID 55667500
methyl 1-[2-[4-[methyl(propan-2-yl)sulfamoyl]anilino]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate (PubChem CID 55667500) has the molecular formula C19H22N4O8S and a molecular weight of 466.47 g/mol. Its IUPAC name is methyl 1-[2-[4-[methyl(propan-2-yl)sulfamoyl]anilino]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate.
| Compound Name | methyl 1-[2-[4-[methyl(propan-2-yl)sulfamoyl]anilino]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 55667500 |
| Molecular Formula | C19H22N4O8S |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | methyl 1-[2-[4-[methyl(propan-2-yl)sulfamoyl]anilino]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(=O)n(CC(=O)Nc2ccc(S(=O)(=O)N(C)C(C)C)cc2)c1 |
| InChI | InChI=1S/C19H22N4O8S/c1-12(2)21(3)32(29,30)15-7-5-14(6-8-15)20-17(24)11-22-10-13(19(26)31-4)9-16(18(22)25)23(27)28/h5-10,12H,11H2,1-4H3,(H,20,24) |
| InChIKey | LCKXTSRDQZBYSR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 157.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|