C18H12Cl2N4O6S — CID 55667426
methyl 1-[2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate (PubChem CID 55667426) has the molecular formula C18H12Cl2N4O6S and a molecular weight of 483.29 g/mol. Its IUPAC name is methyl 1-[2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate.
| Compound Name | methyl 1-[2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 55667426 |
| Molecular Formula | C18H12Cl2N4O6S |
| Molecular Weight | 483.29 g/mol |
| Exact Mass | 481.99 |
| IUPAC Name | methyl 1-[2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(=O)n(CC(=O)Nc2nc(-c3ccc(Cl)c(Cl)c3)cs2)c1 |
| InChI | InChI=1S/C18H12Cl2N4O6S/c1-30-17(27)10-5-14(24(28)29)16(26)23(6-10)7-15(25)22-18-21-13(8-31-18)9-2-3-11(19)12(20)4-9/h2-6,8H,7H2,1H3,(H,21,22,25) |
| InChIKey | OEBLPQWHCXGSSB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|