C20H19N5O5S — CID 39037579
5-nitro-2-oxo-1-[2-oxo-2-[[4-(4-propylphenyl)-1,3-thiazol-2-yl]amino]ethyl]pyridine-3-carboxamide (PubChem CID 39037579) has the molecular formula C20H19N5O5S and a molecular weight of 441.47 g/mol. Its IUPAC name is 5-nitro-2-oxo-1-[2-oxo-2-[[4-(4-propylphenyl)-1,3-thiazol-2-yl]amino]ethyl]pyridine-3-carboxamide.
| Compound Name | 5-nitro-2-oxo-1-[2-oxo-2-[[4-(4-propylphenyl)-1,3-thiazol-2-yl]amino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 39037579 |
| Molecular Formula | C20H19N5O5S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 5-nitro-2-oxo-1-[2-oxo-2-[[4-(4-propylphenyl)-1,3-thiazol-2-yl]amino]ethyl]pyridine-3-carboxamide |
| SMILES | CCCc1ccc(-c2csc(NC(=O)Cn3cc([N+](=O)[O-])cc(C(N)=O)c3=O)n2)cc1 |
| InChI | InChI=1S/C20H19N5O5S/c1-2-3-12-4-6-13(7-5-12)16-11-31-20(22-16)23-17(26)10-24-9-14(25(29)30)8-15(18(21)27)19(24)28/h4-9,11H,2-3,10H2,1H3,(H2,21,27)(H,22,23,26) |
| InChIKey | RFZUHRIPYPNKPV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 150.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|