C19H21N5O6 — CID 55531473
5-nitro-2-oxo-1-[2-oxo-2-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]ethyl]pyridine-3-carboxamide (PubChem CID 55531473) has the molecular formula C19H21N5O6 and a molecular weight of 415.41 g/mol. Its IUPAC name is 5-nitro-2-oxo-1-[2-oxo-2-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]ethyl]pyridine-3-carboxamide.
| Compound Name | 5-nitro-2-oxo-1-[2-oxo-2-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55531473 |
| Molecular Formula | C19H21N5O6 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 5-nitro-2-oxo-1-[2-oxo-2-[[2-oxo-2-(2,4,6-trimethylanilino)ethyl]amino]ethyl]pyridine-3-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)CNC(=O)Cn2cc([N+](=O)[O-])cc(C(N)=O)c2=O)c(C)c1 |
| InChI | InChI=1S/C19H21N5O6/c1-10-4-11(2)17(12(3)5-10)22-15(25)7-21-16(26)9-23-8-13(24(29)30)6-14(18(20)27)19(23)28/h4-6,8H,7,9H2,1-3H3,(H2,20,27)(H,21,26)(H,22,25) |
| InChIKey | KBNKPRLTKVJSCS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 166.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|