C17H25N5O6 — CID 55546364
1-[2-[[4-(2-methylpropyl)morpholin-2-yl]methylamino]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carboxamide (PubChem CID 55546364) has the molecular formula C17H25N5O6 and a molecular weight of 395.42 g/mol. Its IUPAC name is 1-[2-[[4-(2-methylpropyl)morpholin-2-yl]methylamino]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carboxamide.
| Compound Name | 1-[2-[[4-(2-methylpropyl)morpholin-2-yl]methylamino]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 55546364 |
| Molecular Formula | C17H25N5O6 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 1-[2-[[4-(2-methylpropyl)morpholin-2-yl]methylamino]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carboxamide |
| SMILES | CC(C)CN1CCOC(CNC(=O)Cn2cc([N+](=O)[O-])cc(C(N)=O)c2=O)C1 |
| InChI | InChI=1S/C17H25N5O6/c1-11(2)7-20-3-4-28-13(9-20)6-19-15(23)10-21-8-12(22(26)27)5-14(16(18)24)17(21)25/h5,8,11,13H,3-4,6-7,9-10H2,1-2H3,(H2,18,24)(H,19,23) |
| InChIKey | NRDGEAZFQXGCPE-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 149.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|