C17H23N5O5 — CID 55402937
2-(3-cyano-5-nitro-2-oxo-1-pyridinyl)-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]acetamide (PubChem CID 55402937) has the molecular formula C17H23N5O5 and a molecular weight of 377.40 g/mol. Its IUPAC name is 2-(3-cyano-5-nitro-2-oxo-1-pyridinyl)-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]acetamide.
| Compound Name | 2-(3-cyano-5-nitro-2-oxo-1-pyridinyl)-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 55402937 |
| Molecular Formula | C17H23N5O5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-(3-cyano-5-nitro-2-oxo-1-pyridinyl)-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]acetamide |
| SMILES | CC(C)CN1CCOC(CNC(=O)Cn2cc([N+](=O)[O-])cc(C#N)c2=O)C1 |
| InChI | InChI=1S/C17H23N5O5/c1-12(2)8-20-3-4-27-15(10-20)7-19-16(23)11-21-9-14(22(25)26)5-13(6-18)17(21)24/h5,9,12,15H,3-4,7-8,10-11H2,1-2H3,(H,19,23) |
| InChIKey | XRDNQCNEDLFCDA-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 130.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|