C17H23FN4O2 — CID 78838978
1-(2-cyano-4-fluorophenyl)-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]urea (PubChem CID 78838978) has the molecular formula C17H23FN4O2 and a molecular weight of 334.40 g/mol. Its IUPAC name is 1-(2-cyano-4-fluorophenyl)-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]urea.
| Compound Name | 1-(2-cyano-4-fluorophenyl)-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 78838978 |
| Molecular Formula | C17H23FN4O2 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 1-(2-cyano-4-fluorophenyl)-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]urea |
| SMILES | CC(C)CN1CCOC(CNC(=O)Nc2ccc(F)cc2C#N)C1 |
| InChI | InChI=1S/C17H23FN4O2/c1-12(2)10-22-5-6-24-15(11-22)9-20-17(23)21-16-4-3-14(18)7-13(16)8-19/h3-4,7,12,15H,5-6,9-11H2,1-2H3,(H2,20,21,23) |
| InChIKey | SQQPAGCZPRHMPL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |