C13H23N5O2 — CID 94178633
1-[[(2S)-4-(2-methylpropyl)morpholin-2-yl]methyl]-3-(1H-pyrazol-4-yl)urea (PubChem CID 94178633) has the molecular formula C13H23N5O2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-[[(2S)-4-(2-methylpropyl)morpholin-2-yl]methyl]-3-(1H-pyrazol-4-yl)urea.
| Compound Name | 1-[[(2S)-4-(2-methylpropyl)morpholin-2-yl]methyl]-3-(1H-pyrazol-4-yl)urea |
|---|---|
| PubChem CID | 94178633 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 1-[[(2S)-4-(2-methylpropyl)morpholin-2-yl]methyl]-3-(1H-pyrazol-4-yl)urea |
| SMILES | CC(C)CN1CCO[C@@H](CNC(=O)Nc2cn[nH]c2)C1 |
| InChI | InChI=1S/C13H23N5O2/c1-10(2)8-18-3-4-20-12(9-18)7-14-13(19)17-11-5-15-16-6-11/h5-6,10,12H,3-4,7-9H2,1-2H3,(H,15,16)(H2,14,17,19)/t12-/m0/s1 |
| InChIKey | DFSZJCMMMBSMGK-LBPRGKRZSA-N |
| XLogP | 0.89 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |