C22H30N4O2S — CID 56554413
1-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-[3-(pyridin-2-ylsulfanylmethyl)phenyl]urea (PubChem CID 56554413) has the molecular formula C22H30N4O2S and a molecular weight of 414.58 g/mol. Its IUPAC name is 1-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-[3-(pyridin-2-ylsulfanylmethyl)phenyl]urea.
| Compound Name | 1-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-[3-(pyridin-2-ylsulfanylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 56554413 |
| Molecular Formula | C22H30N4O2S |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 1-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-[3-(pyridin-2-ylsulfanylmethyl)phenyl]urea |
| SMILES | CC(C)CN1CCOC(CNC(=O)Nc2cccc(CSc3ccccn3)c2)C1 |
| InChI | InChI=1S/C22H30N4O2S/c1-17(2)14-26-10-11-28-20(15-26)13-24-22(27)25-19-7-5-6-18(12-19)16-29-21-8-3-4-9-23-21/h3-9,12,17,20H,10-11,13-16H2,1-2H3,(H2,24,25,27) |
| InChIKey | KMQXCRSGGUKVBY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |