C25H27ClN4O3 — CID 60600735
1-[(4-benzylmorpholin-2-yl)methyl]-3-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]urea (PubChem CID 60600735) has the molecular formula C25H27ClN4O3 and a molecular weight of 466.97 g/mol. Its IUPAC name is 1-[(4-benzylmorpholin-2-yl)methyl]-3-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]urea.
| Compound Name | 1-[(4-benzylmorpholin-2-yl)methyl]-3-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]urea |
|---|---|
| PubChem CID | 60600735 |
| Molecular Formula | C25H27ClN4O3 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 1-[(4-benzylmorpholin-2-yl)methyl]-3-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]urea |
| SMILES | O=C(NCC1CN(Cc2ccccc2)CCO1)Nc1ccc(OCc2ccccn2)c(Cl)c1 |
| InChI | InChI=1S/C25H27ClN4O3/c26-23-14-20(9-10-24(23)33-18-21-8-4-5-11-27-21)29-25(31)28-15-22-17-30(12-13-32-22)16-19-6-2-1-3-7-19/h1-11,14,22H,12-13,15-18H2,(H2,28,29,31) |
| InChIKey | ZHWSLCLIPSRVSR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |