C24H23ClN4O3 — CID 60600985
4-benzoyl-N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]piperazine-1-carboxamide (PubChem CID 60600985) has the molecular formula C24H23ClN4O3 and a molecular weight of 450.93 g/mol. Its IUPAC name is 4-benzoyl-N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-benzoyl-N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 60600985 |
| Molecular Formula | C24H23ClN4O3 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 4-benzoyl-N-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(OCc2ccccn2)c(Cl)c1)N1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H23ClN4O3/c25-21-16-19(9-10-22(21)32-17-20-8-4-5-11-26-20)27-24(31)29-14-12-28(13-15-29)23(30)18-6-2-1-3-7-18/h1-11,16H,12-15,17H2,(H,27,31) |
| InChIKey | LQFAPNKVRDDSSI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |