C16H17ClN4O3 — CID 60601007
2-[[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]carbamoylamino]-N-methylacetamide (PubChem CID 60601007) has the molecular formula C16H17ClN4O3 and a molecular weight of 348.79 g/mol. Its IUPAC name is 2-[[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]carbamoylamino]-N-methylacetamide.
| Compound Name | 2-[[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]carbamoylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 60601007 |
| Molecular Formula | C16H17ClN4O3 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 2-[[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]carbamoylamino]-N-methylacetamide |
| SMILES | CNC(=O)CNC(=O)Nc1ccc(OCc2ccccn2)c(Cl)c1 |
| InChI | InChI=1S/C16H17ClN4O3/c1-18-15(22)9-20-16(23)21-11-5-6-14(13(17)8-11)24-10-12-4-2-3-7-19-12/h2-8H,9-10H2,1H3,(H,18,22)(H2,20,21,23) |
| InChIKey | RHHIKIPPGMSMKV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |