C21H19Cl2N3O2 — CID 52783528
(2R)-N-(3-chlorophenyl)-2-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]propanamide (PubChem CID 52783528) has the molecular formula C21H19Cl2N3O2 and a molecular weight of 416.31 g/mol. Its IUPAC name is (2R)-N-(3-chlorophenyl)-2-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]propanamide.
| Compound Name | (2R)-N-(3-chlorophenyl)-2-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]propanamide |
|---|---|
| PubChem CID | 52783528 |
| Molecular Formula | C21H19Cl2N3O2 |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | (2R)-N-(3-chlorophenyl)-2-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]propanamide |
| SMILES | C[C@@H](Nc1ccc(OCc2ccccn2)c(Cl)c1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H19Cl2N3O2/c1-14(21(27)26-16-7-4-5-15(22)11-16)25-17-8-9-20(19(23)12-17)28-13-18-6-2-3-10-24-18/h2-12,14,25H,13H2,1H3,(H,26,27)/t14-/m1/s1 |
| InChIKey | NCMLPWYLZXCKJP-CQSZACIVSA-N |
| XLogP | 5.41 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|