C25H21ClN6O3 — CID 42602304
(2S)-N-[3-[[6-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrimidin-4-yl]amino]phenyl]oxirane-2-carboxamide (PubChem CID 42602304) has the molecular formula C25H21ClN6O3 and a molecular weight of 488.94 g/mol. Its IUPAC name is (2S)-N-[3-[[6-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrimidin-4-yl]amino]phenyl]oxirane-2-carboxamide.
| Compound Name | (2S)-N-[3-[[6-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrimidin-4-yl]amino]phenyl]oxirane-2-carboxamide |
|---|---|
| PubChem CID | 42602304 |
| Molecular Formula | C25H21ClN6O3 |
| Molecular Weight | 488.94 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | (2S)-N-[3-[[6-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrimidin-4-yl]amino]phenyl]oxirane-2-carboxamide |
| SMILES | O=C(Nc1cccc(Nc2cc(Nc3ccc(OCc4ccccn4)c(Cl)c3)ncn2)c1)[C@@H]1CO1 |
| InChI | InChI=1S/C25H21ClN6O3/c26-20-11-18(7-8-21(20)34-13-19-4-1-2-9-27-19)31-24-12-23(28-15-29-24)30-16-5-3-6-17(10-16)32-25(33)22-14-35-22/h1-12,15,22H,13-14H2,(H,32,33)(H2,28,29,30,31)/t22-/m0/s1 |
| InChIKey | KORNFADWYHAJGR-QFIPXVFZSA-N |
| XLogP | 4.93 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.94 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|