C28H28ClN7O2 — CID 42602132
(E)-N-[3-[[6-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrimidin-4-yl]amino]phenyl]-4-(dimethylamino)but-2-enamide (PubChem CID 42602132) has the molecular formula C28H28ClN7O2 and a molecular weight of 530.03 g/mol. Its IUPAC name is (E)-N-[3-[[6-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrimidin-4-yl]amino]phenyl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[3-[[6-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrimidin-4-yl]amino]phenyl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 42602132 |
| Molecular Formula | C28H28ClN7O2 |
| Molecular Weight | 530.03 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | (E)-N-[3-[[6-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrimidin-4-yl]amino]phenyl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1cccc(Nc2cc(Nc3ccc(OCc4ccccn4)c(Cl)c3)ncn2)c1 |
| InChI | InChI=1S/C28H28ClN7O2/c1-36(2)14-6-10-28(37)35-21-9-5-8-20(15-21)33-26-17-27(32-19-31-26)34-22-11-12-25(24(29)16-22)38-18-23-7-3-4-13-30-23/h3-13,15-17,19H,14,18H2,1-2H3,(H,35,37)(H2,31,32,33,34)/b10-6+ |
| InChIKey | IJWQVCTZFAJGBQ-UXBLZVDNSA-N |
| XLogP | 5.65 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.03 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|