C32H29ClN6O6 — CID 162313922
(Z)-but-2-enedioic acid;(E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyanoquinolin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 162313922) has the molecular formula C32H29ClN6O6 and a molecular weight of 629.07 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyanoquinolin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (Z)-but-2-enedioic acid;(E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyanoquinolin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 162313922 |
| Molecular Formula | C32H29ClN6O6 |
| Molecular Weight | 629.07 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | (Z)-but-2-enedioic acid;(E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyanoquinolin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1ccc2ncc(C#N)c(Nc3ccc(OCc4ccccn4)c(Cl)c3)c2c1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C28H25ClN6O2.C4H4O4/c1-35(2)13-5-7-27(36)33-20-8-10-25-23(14-20)28(19(16-30)17-32-25)34-21-9-11-26(24(29)15-21)37-18-22-6-3-4-12-31-22;5-3(6)1-2-4(7)8/h3-12,14-15,17H,13,18H2,1-2H3,(H,32,34)(H,33,36);1-2H,(H,5,6)(H,7,8)/b7-5+;2-1- |
| InChIKey | OOBGNYOMAIURKK-KPFLPOEASA-N |
| XLogP | 5.25 |
| TPSA | 177.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.07 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|