C32H31ClN6O4 — CID 146255728
(E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-8-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 146255728) has the molecular formula C32H31ClN6O4 and a molecular weight of 599.09 g/mol. Its IUPAC name is (E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-8-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-8-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 146255728 |
| Molecular Formula | C32H31ClN6O4 |
| Molecular Weight | 599.09 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | (E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-8-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1c(OC2CCOC2)ccc2c(Nc3ccc(OCc4ccccn4)c(Cl)c3)c(C#N)cnc12 |
| InChI | InChI=1S/C32H31ClN6O4/c1-39(2)14-5-7-29(40)38-32-28(43-24-12-15-41-20-24)11-9-25-30(21(17-34)18-36-31(25)32)37-22-8-10-27(26(33)16-22)42-19-23-6-3-4-13-35-23/h3-11,13,16,18,24H,12,14-15,19-20H2,1-2H3,(H,36,37)(H,38,40)/b7-5+ |
| InChIKey | FUEMGRZRARIUTK-FNORWQNLSA-N |
| XLogP | 5.70 |
| TPSA | 121.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.09 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|