C34H33ClFN5O5 — CID 146255755
(E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-8-yl]-4-[[(1S)-1-hydroxyethyl]-methylamino]but-2-enamide (PubChem CID 146255755) has the molecular formula C34H33ClFN5O5 and a molecular weight of 646.12 g/mol. Its IUPAC name is (E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-8-yl]-4-[[(1S)-1-hydroxyethyl]-methylamino]but-2-enamide.
| Compound Name | (E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-8-yl]-4-[[(1S)-1-hydroxyethyl]-methylamino]but-2-enamide |
|---|---|
| PubChem CID | 146255755 |
| Molecular Formula | C34H33ClFN5O5 |
| Molecular Weight | 646.12 g/mol |
| Exact Mass | 645.22 |
| IUPAC Name | (E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-8-yl]-4-[[(1S)-1-hydroxyethyl]-methylamino]but-2-enamide |
| SMILES | C[C@H](O)N(C)C/C=C/C(=O)Nc1c(O[C@H]2CCOC2)ccc2c(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c(C#N)cnc12 |
| InChI | InChI=1S/C34H33ClFN5O5/c1-21(42)41(2)13-4-7-31(43)40-34-30(46-26-12-14-44-20-26)11-9-27-32(23(17-37)18-38-33(27)34)39-25-8-10-29(28(35)16-25)45-19-22-5-3-6-24(36)15-22/h3-11,15-16,18,21,26,42H,12-14,19-20H2,1-2H3,(H,38,39)(H,40,43)/b7-4+/t21-,26-/m0/s1 |
| InChIKey | RHAPAQHQMRAZHL-FQOOBEDMSA-N |
| XLogP | 6.15 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.12 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|