C29H29N5O4 — CID 146255801
(E)-N-[3-cyano-4-(3-ethynylanilino)-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]-4-[[(1S)-1-hydroxyethyl]-methylamino]but-2-enamide (PubChem CID 146255801) has the molecular formula C29H29N5O4 and a molecular weight of 511.58 g/mol. Its IUPAC name is (E)-N-[3-cyano-4-(3-ethynylanilino)-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]-4-[[(1S)-1-hydroxyethyl]-methylamino]but-2-enamide.
| Compound Name | (E)-N-[3-cyano-4-(3-ethynylanilino)-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]-4-[[(1S)-1-hydroxyethyl]-methylamino]but-2-enamide |
|---|---|
| PubChem CID | 146255801 |
| Molecular Formula | C29H29N5O4 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | (E)-N-[3-cyano-4-(3-ethynylanilino)-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]-4-[[(1S)-1-hydroxyethyl]-methylamino]but-2-enamide |
| SMILES | C#Cc1cccc(Nc2c(C#N)cnc3cc(O[C@H]4CCOC4)c(NC(=O)/C=C/CN(C)[C@H](C)O)cc23)c1 |
| InChI | InChI=1S/C29H29N5O4/c1-4-20-7-5-8-22(13-20)32-29-21(16-30)17-31-25-15-27(38-23-10-12-37-18-23)26(14-24(25)29)33-28(36)9-6-11-34(3)19(2)35/h1,5-9,13-15,17,19,23,35H,10-12,18H2,2-3H3,(H,31,32)(H,33,36)/b9-6+/t19-,23-/m0/s1 |
| InChIKey | YDEWYUJHXDLLNZ-MUSUUQTNSA-N |
| XLogP | 3.76 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|