C31H35ClFN5O4 — CID 123569397
N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]-4-[6-hydroxyhexyl(methyl)amino]but-2-enamide (PubChem CID 123569397) has the molecular formula C31H35ClFN5O4 and a molecular weight of 596.10 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]-4-[6-hydroxyhexyl(methyl)amino]but-2-enamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]-4-[6-hydroxyhexyl(methyl)amino]but-2-enamide |
|---|---|
| PubChem CID | 123569397 |
| Molecular Formula | C31H35ClFN5O4 |
| Molecular Weight | 596.10 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]-4-[6-hydroxyhexyl(methyl)amino]but-2-enamide |
| SMILES | CN(CC=CC(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)c(C#N)cnc2cc1O[C@H]1CCOC1)CCCCCCO |
| InChI | InChI=1S/C31H35ClFN5O4/c1-38(11-4-2-3-5-13-39)12-6-7-30(40)37-28-16-24-27(17-29(28)42-23-10-14-41-20-23)35-19-21(18-34)31(24)36-22-8-9-26(33)25(32)15-22/h6-9,15-17,19,23,39H,2-5,10-14,20H2,1H3,(H,35,36)(H,37,40)/t23-/m0/s1 |
| InChIKey | IKDLDQJUBYCRRZ-QHCPKHFHSA-N |
| XLogP | 5.79 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.10 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|