C23H21ClFN5O3 — CID 136590770
(E)-N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-hydroxyquinolin-6-yl]-4-[2-hydroxyethyl(methyl)amino]but-2-enamide (PubChem CID 136590770) has the molecular formula C23H21ClFN5O3 and a molecular weight of 469.90 g/mol. Its IUPAC name is (E)-N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-hydroxyquinolin-6-yl]-4-[2-hydroxyethyl(methyl)amino]but-2-enamide.
| Compound Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-hydroxyquinolin-6-yl]-4-[2-hydroxyethyl(methyl)amino]but-2-enamide |
|---|---|
| PubChem CID | 136590770 |
| Molecular Formula | C23H21ClFN5O3 |
| Molecular Weight | 469.90 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-hydroxyquinolin-6-yl]-4-[2-hydroxyethyl(methyl)amino]but-2-enamide |
| SMILES | CN(C/C=C/C(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)c(C#N)cnc2cc1O)CCO |
| InChI | InChI=1S/C23H21ClFN5O3/c1-30(7-8-31)6-2-3-22(33)29-20-10-16-19(11-21(20)32)27-13-14(12-26)23(16)28-15-4-5-18(25)17(24)9-15/h2-5,9-11,13,31-32H,6-8H2,1H3,(H,27,28)(H,29,33)/b3-2+ |
| InChIKey | HGBJAHBEVJILNG-NSCUHMNNSA-N |
| XLogP | 3.77 |
| TPSA | 121.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.90 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|