C22H19BrFN5O — CID 54147240
N-[4-(3-bromo-4-fluoroanilino)-3-cyanoquinolin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 54147240) has the molecular formula C22H19BrFN5O and a molecular weight of 468.33 g/mol. Its IUPAC name is N-[4-(3-bromo-4-fluoroanilino)-3-cyanoquinolin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | N-[4-(3-bromo-4-fluoroanilino)-3-cyanoquinolin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 54147240 |
| Molecular Formula | C22H19BrFN5O |
| Molecular Weight | 468.33 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | N-[4-(3-bromo-4-fluoroanilino)-3-cyanoquinolin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)CC=CC(=O)Nc1ccc2ncc(C#N)c(Nc3ccc(F)c(Br)c3)c2c1 |
| InChI | InChI=1S/C22H19BrFN5O/c1-29(2)9-3-4-21(30)27-15-6-8-20-17(10-15)22(14(12-25)13-26-20)28-16-5-7-19(24)18(23)11-16/h3-8,10-11,13H,9H2,1-2H3,(H,26,28)(H,27,30) |
| InChIKey | OFGJOXKWOLGBRC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.33 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|