C26H24ClN7O2 — CID 69048220
N-[4-(3-chloro-4-imidazol-1-ylanilino)-3-cyano-7-methoxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 69048220) has the molecular formula C26H24ClN7O2 and a molecular weight of 501.98 g/mol. Its IUPAC name is N-[4-(3-chloro-4-imidazol-1-ylanilino)-3-cyano-7-methoxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | N-[4-(3-chloro-4-imidazol-1-ylanilino)-3-cyano-7-methoxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 69048220 |
| Molecular Formula | C26H24ClN7O2 |
| Molecular Weight | 501.98 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | N-[4-(3-chloro-4-imidazol-1-ylanilino)-3-cyano-7-methoxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | COc1cc2ncc(C#N)c(Nc3ccc(-n4ccnc4)c(Cl)c3)c2cc1NC(=O)C=CCN(C)C |
| InChI | InChI=1S/C26H24ClN7O2/c1-33(2)9-4-5-25(35)32-22-12-19-21(13-24(22)36-3)30-15-17(14-28)26(19)31-18-6-7-23(20(27)11-18)34-10-8-29-16-34/h4-8,10-13,15-16H,9H2,1-3H3,(H,30,31)(H,32,35) |
| InChIKey | OCOAWZRMFFUFOR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 108.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.98 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|