C32H31ClFN5O4 — CID 90969944
4-[bis(trideuteriomethyl)amino]-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-(2-methoxyethoxy)quinolin-6-yl]but-2-enamide (PubChem CID 90969944) has the molecular formula C32H31ClFN5O4 and a molecular weight of 610.12 g/mol. Its IUPAC name is 4-[bis(trideuteriomethyl)amino]-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-(2-methoxyethoxy)quinolin-6-yl]but-2-enamide.
| Compound Name | 4-[bis(trideuteriomethyl)amino]-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-(2-methoxyethoxy)quinolin-6-yl]but-2-enamide |
|---|---|
| PubChem CID | 90969944 |
| Molecular Formula | C32H31ClFN5O4 |
| Molecular Weight | 610.12 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | 4-[bis(trideuteriomethyl)amino]-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-(2-methoxyethoxy)quinolin-6-yl]but-2-enamide |
| SMILES | [2H]C([2H])([2H])N(CC=CC(=O)Nc1cc2c(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c(C#N)cnc2cc1OCCOC)C([2H])([2H])[2H] |
| InChI | InChI=1S/C32H31ClFN5O4/c1-39(2)11-5-8-31(40)38-28-16-25-27(17-30(28)42-13-12-41-3)36-19-22(18-35)32(25)37-24-9-10-29(26(33)15-24)43-20-21-6-4-7-23(34)14-21/h4-10,14-17,19H,11-13,20H2,1-3H3,(H,36,37)(H,38,40)/i1D3,2D3 |
| InChIKey | LCCDGXNKBDUAMX-WFGJKAKNSA-N |
| XLogP | 6.30 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.12 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|