C33H31Cl2N5O4 — CID 123316787
N-[4-[3-chloro-4-[(3-chlorophenyl)methoxy]anilino]-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 123316787) has the molecular formula C33H31Cl2N5O4 and a molecular weight of 632.55 g/mol. Its IUPAC name is N-[4-[3-chloro-4-[(3-chlorophenyl)methoxy]anilino]-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | N-[4-[3-chloro-4-[(3-chlorophenyl)methoxy]anilino]-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 123316787 |
| Molecular Formula | C33H31Cl2N5O4 |
| Molecular Weight | 632.55 g/mol |
| Exact Mass | 631.18 |
| IUPAC Name | N-[4-[3-chloro-4-[(3-chlorophenyl)methoxy]anilino]-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)CC=CC(=O)Nc1cc2c(Nc3ccc(OCc4cccc(Cl)c4)c(Cl)c3)c(C#N)cnc2cc1O[C@H]1CCOC1 |
| InChI | InChI=1S/C33H31Cl2N5O4/c1-40(2)11-4-7-32(41)39-29-15-26-28(16-31(29)44-25-10-12-42-20-25)37-18-22(17-36)33(26)38-24-8-9-30(27(35)14-24)43-19-21-5-3-6-23(34)13-21/h3-9,13-16,18,25H,10-12,19-20H2,1-2H3,(H,37,38)(H,39,41)/t25-/m0/s1 |
| InChIKey | FEUZHTDLXRRROE-VWLOTQADSA-N |
| XLogP | 6.96 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.55 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|