C32H28ClN7O4 — CID 174685613
(E)-N-[4-[3-chloro-4-[(2-cyanophenyl)methoxy]anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-4-hydrazinylbut-2-enamide (PubChem CID 174685613) has the molecular formula C32H28ClN7O4 and a molecular weight of 610.07 g/mol. Its IUPAC name is (E)-N-[4-[3-chloro-4-[(2-cyanophenyl)methoxy]anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-4-hydrazinylbut-2-enamide.
| Compound Name | (E)-N-[4-[3-chloro-4-[(2-cyanophenyl)methoxy]anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-4-hydrazinylbut-2-enamide |
|---|---|
| PubChem CID | 174685613 |
| Molecular Formula | C32H28ClN7O4 |
| Molecular Weight | 610.07 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | (E)-N-[4-[3-chloro-4-[(2-cyanophenyl)methoxy]anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-4-hydrazinylbut-2-enamide |
| SMILES | N#Cc1ccccc1COc1ccc(Nc2c(C#N)cnc3cc(OC4CCOC4)c(NC(=O)/C=C/CNN)cc23)cc1Cl |
| InChI | InChI=1S/C32H28ClN7O4/c33-26-12-23(7-8-29(26)43-18-21-5-2-1-4-20(21)15-34)39-32-22(16-35)17-37-27-14-30(44-24-9-11-42-19-24)28(13-25(27)32)40-31(41)6-3-10-38-36/h1-8,12-14,17,24,38H,9-11,18-19,36H2,(H,37,39)(H,40,41)/b6-3+ |
| InChIKey | OUZTZZZVNWZNNK-ZZXKWVIFSA-N |
| XLogP | 5.08 |
| TPSA | 167.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.07 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|