C34H32ClN5O5 — CID 174673873
N-[4-[3-chloro-4-[(2-hydroxyphenyl)methoxy]anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-2-piperidin-4-ylideneacetamide (PubChem CID 174673873) has the molecular formula C34H32ClN5O5 and a molecular weight of 626.11 g/mol. Its IUPAC name is N-[4-[3-chloro-4-[(2-hydroxyphenyl)methoxy]anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-2-piperidin-4-ylideneacetamide.
| Compound Name | N-[4-[3-chloro-4-[(2-hydroxyphenyl)methoxy]anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-2-piperidin-4-ylideneacetamide |
|---|---|
| PubChem CID | 174673873 |
| Molecular Formula | C34H32ClN5O5 |
| Molecular Weight | 626.11 g/mol |
| Exact Mass | 625.21 |
| IUPAC Name | N-[4-[3-chloro-4-[(2-hydroxyphenyl)methoxy]anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-2-piperidin-4-ylideneacetamide |
| SMILES | N#Cc1cnc2cc(OC3CCOC3)c(NC(=O)C=C3CCNCC3)cc2c1Nc1ccc(OCc2ccccc2O)c(Cl)c1 |
| InChI | InChI=1S/C34H32ClN5O5/c35-27-14-24(5-6-31(27)44-19-22-3-1-2-4-30(22)41)39-34-23(17-36)18-38-28-16-32(45-25-9-12-43-20-25)29(15-26(28)34)40-33(42)13-21-7-10-37-11-8-21/h1-6,13-16,18,25,37,41H,7-12,19-20H2,(H,38,39)(H,40,42) |
| InChIKey | BREYEBCKHLUMEW-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 137.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.11 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|