C34H35ClN6O6 — CID 146255799
(E)-4-[bis[(1S)-1-hydroxyethyl]amino]-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]but-2-enamide (PubChem CID 146255799) has the molecular formula C34H35ClN6O6 and a molecular weight of 659.14 g/mol. Its IUPAC name is (E)-4-[bis[(1S)-1-hydroxyethyl]amino]-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]but-2-enamide.
| Compound Name | (E)-4-[bis[(1S)-1-hydroxyethyl]amino]-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]but-2-enamide |
|---|---|
| PubChem CID | 146255799 |
| Molecular Formula | C34H35ClN6O6 |
| Molecular Weight | 659.14 g/mol |
| Exact Mass | 658.23 |
| IUPAC Name | (E)-4-[bis[(1S)-1-hydroxyethyl]amino]-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]but-2-enamide |
| SMILES | C[C@H](O)N(C/C=C/C(=O)Nc1cc2c(Nc3ccc(OCc4ccccn4)c(Cl)c3)c(C#N)cnc2cc1O[C@H]1CCOC1)[C@H](C)O |
| InChI | InChI=1S/C34H35ClN6O6/c1-21(42)41(22(2)43)12-5-7-33(44)40-30-15-27-29(16-32(30)47-26-10-13-45-20-26)38-18-23(17-36)34(27)39-24-8-9-31(28(35)14-24)46-19-25-6-3-4-11-37-25/h3-9,11,14-16,18,21-22,26,42-43H,10,12-13,19-20H2,1-2H3,(H,38,39)(H,40,44)/b7-5+/t21-,22-,26-/m0/s1 |
| InChIKey | FELLWIMQCSRSKY-SXHLRSJXSA-N |
| XLogP | 5.12 |
| TPSA | 162.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.14 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|