C34H35ClN6O4 — CID 146255833
(E)-4-(tert-butylamino)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-8-yl]but-2-enamide (PubChem CID 146255833) has the molecular formula C34H35ClN6O4 and a molecular weight of 627.15 g/mol. Its IUPAC name is (E)-4-(tert-butylamino)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-8-yl]but-2-enamide.
| Compound Name | (E)-4-(tert-butylamino)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-8-yl]but-2-enamide |
|---|---|
| PubChem CID | 146255833 |
| Molecular Formula | C34H35ClN6O4 |
| Molecular Weight | 627.15 g/mol |
| Exact Mass | 626.24 |
| IUPAC Name | (E)-4-(tert-butylamino)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-8-yl]but-2-enamide |
| SMILES | CC(C)(C)NC/C=C/C(=O)Nc1c(O[C@H]2CCOC2)ccc2c(Nc3ccc(OCc4ccccn4)c(Cl)c3)c(C#N)cnc12 |
| InChI | InChI=1S/C34H35ClN6O4/c1-34(2,3)39-15-6-8-30(42)41-33-29(45-25-13-16-43-21-25)12-10-26-31(22(18-36)19-38-32(26)33)40-23-9-11-28(27(35)17-23)44-20-24-7-4-5-14-37-24/h4-12,14,17,19,25,39H,13,15-16,20-21H2,1-3H3,(H,38,40)(H,41,42)/b8-6+/t25-/m0/s1 |
| InChIKey | ONGDDGSSSFREHR-VQEXNLMWSA-N |
| XLogP | 6.53 |
| TPSA | 130.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.15 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|