C34H34ClN5O4 — CID 146255830
(E)-N-[4-[3-chloro-4-[(3-methylphenyl)methoxy]anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-8-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 146255830) has the molecular formula C34H34ClN5O4 and a molecular weight of 612.13 g/mol. Its IUPAC name is (E)-N-[4-[3-chloro-4-[(3-methylphenyl)methoxy]anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-8-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[4-[3-chloro-4-[(3-methylphenyl)methoxy]anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-8-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 146255830 |
| Molecular Formula | C34H34ClN5O4 |
| Molecular Weight | 612.13 g/mol |
| Exact Mass | 611.23 |
| IUPAC Name | (E)-N-[4-[3-chloro-4-[(3-methylphenyl)methoxy]anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-8-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | Cc1cccc(COc2ccc(Nc3c(C#N)cnc4c(NC(=O)/C=C/CN(C)C)c(OC5CCOC5)ccc34)cc2Cl)c1 |
| InChI | InChI=1S/C34H34ClN5O4/c1-22-6-4-7-23(16-22)20-43-29-11-9-25(17-28(29)35)38-32-24(18-36)19-37-33-27(32)10-12-30(44-26-13-15-42-21-26)34(33)39-31(41)8-5-14-40(2)3/h4-12,16-17,19,26H,13-15,20-21H2,1-3H3,(H,37,38)(H,39,41)/b8-5+ |
| InChIKey | AULBDMPNKXXECS-VMPITWQZSA-N |
| XLogP | 6.61 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.13 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|