C35H35ClFN5O5 — CID 89496183
(E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-4-(2-ethoxyethylamino)but-2-enamide (PubChem CID 89496183) has the molecular formula C35H35ClFN5O5 and a molecular weight of 660.15 g/mol. Its IUPAC name is (E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-4-(2-ethoxyethylamino)but-2-enamide.
| Compound Name | (E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-4-(2-ethoxyethylamino)but-2-enamide |
|---|---|
| PubChem CID | 89496183 |
| Molecular Formula | C35H35ClFN5O5 |
| Molecular Weight | 660.15 g/mol |
| Exact Mass | 659.23 |
| IUPAC Name | (E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-4-(2-ethoxyethylamino)but-2-enamide |
| SMILES | CCOCCNC/C=C/C(=O)Nc1cc2c(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c(C#N)cnc2cc1OC1CCOC1 |
| InChI | InChI=1S/C35H35ClFN5O5/c1-2-44-14-12-39-11-4-7-34(43)42-31-17-28-30(18-33(31)47-27-10-13-45-22-27)40-20-24(19-38)35(28)41-26-8-9-32(29(36)16-26)46-21-23-5-3-6-25(37)15-23/h3-9,15-18,20,27,39H,2,10-14,21-22H2,1H3,(H,40,41)(H,42,43)/b7-4+ |
| InChIKey | BCWZETNSPKVNOM-QPJJXVBHSA-N |
| XLogP | 6.51 |
| TPSA | 126.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.15 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|