C30H29ClFN5O4 — CID 66556963
(E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-3-(dimethylamino)prop-2-enamide (PubChem CID 66556963) has the molecular formula C30H29ClFN5O4 and a molecular weight of 578.04 g/mol. Its IUPAC name is (E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-3-(dimethylamino)prop-2-enamide.
| Compound Name | (E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-3-(dimethylamino)prop-2-enamide |
|---|---|
| PubChem CID | 66556963 |
| Molecular Formula | C30H29ClFN5O4 |
| Molecular Weight | 578.04 g/mol |
| Exact Mass | 577.19 |
| IUPAC Name | (E)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-3-(dimethylamino)prop-2-enamide |
| SMILES | CN(C)/C=C/C(=O)Nc1cc2c(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)ncnc2cc1O[C@H]1CCOC1 |
| InChI | InChI=1S/C30H29ClFN5O4/c1-37(2)10-8-29(38)36-26-14-23-25(15-28(26)41-22-9-11-39-17-22)33-18-34-30(23)35-21-6-7-27(24(31)13-21)40-16-19-4-3-5-20(32)12-19/h3-8,10,12-15,18,22H,9,11,16-17H2,1-2H3,(H,36,38)(H,33,34,35)/b10-8+/t22-/m0/s1 |
| InChIKey | MRILSJQMBOONOX-RCHCNPRSSA-N |
| XLogP | 5.93 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.04 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|