C24H25ClFN5O3 — CID 66780352
4-[[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]amino]-N,N-dimethylbut-2-enamide (PubChem CID 66780352) has the molecular formula C24H25ClFN5O3 and a molecular weight of 485.95 g/mol. Its IUPAC name is 4-[[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]amino]-N,N-dimethylbut-2-enamide.
| Compound Name | 4-[[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]amino]-N,N-dimethylbut-2-enamide |
|---|---|
| PubChem CID | 66780352 |
| Molecular Formula | C24H25ClFN5O3 |
| Molecular Weight | 485.95 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 4-[[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]amino]-N,N-dimethylbut-2-enamide |
| SMILES | CN(C)C(=O)C=CCNc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1O[C@H]1CCOC1 |
| InChI | InChI=1S/C24H25ClFN5O3/c1-31(2)23(32)4-3-8-27-21-11-17-20(12-22(21)34-16-7-9-33-13-16)28-14-29-24(17)30-15-5-6-19(26)18(25)10-15/h3-6,10-12,14,16,27H,7-9,13H2,1-2H3,(H,28,29,30)/t16-/m0/s1 |
| InChIKey | XOQVTMSSFNEYOQ-INIZCTEOSA-N |
| XLogP | 4.39 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.95 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|