C19H18ClFN6O3 — CID 174996184
1-amino-3-[4-(3-chloro-4-fluoroanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]urea (PubChem CID 174996184) has the molecular formula C19H18ClFN6O3 and a molecular weight of 432.84 g/mol. Its IUPAC name is 1-amino-3-[4-(3-chloro-4-fluoroanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]urea.
| Compound Name | 1-amino-3-[4-(3-chloro-4-fluoroanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]urea |
|---|---|
| PubChem CID | 174996184 |
| Molecular Formula | C19H18ClFN6O3 |
| Molecular Weight | 432.84 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 1-amino-3-[4-(3-chloro-4-fluoroanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]urea |
| SMILES | NNC(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OC1CCOC1 |
| InChI | InChI=1S/C19H18ClFN6O3/c20-13-5-10(1-2-14(13)21)25-18-12-6-16(26-19(28)27-22)17(7-15(12)23-9-24-18)30-11-3-4-29-8-11/h1-2,5-7,9,11H,3-4,8,22H2,(H,23,24,25)(H2,26,27,28) |
| InChIKey | VSINLXSSBYMIGX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.84 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|