C19H17ClFN3O3 — CID 10216011
N-(3-chloro-4-fluorophenyl)-7-methoxy-6-[(3S)-oxolan-3-yl]oxyquinazolin-4-amine (PubChem CID 10216011) has the molecular formula C19H17ClFN3O3 and a molecular weight of 389.81 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-7-methoxy-6-[(3S)-oxolan-3-yl]oxyquinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-7-methoxy-6-[(3S)-oxolan-3-yl]oxyquinazolin-4-amine |
|---|---|
| PubChem CID | 10216011 |
| Molecular Formula | C19H17ClFN3O3 |
| Molecular Weight | 389.81 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-7-methoxy-6-[(3S)-oxolan-3-yl]oxyquinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1O[C@H]1CCOC1 |
| InChI | InChI=1S/C19H17ClFN3O3/c1-25-17-8-16-13(7-18(17)27-12-4-5-26-9-12)19(23-10-22-16)24-11-2-3-15(21)14(20)6-11/h2-3,6-8,10,12H,4-5,9H2,1H3,(H,22,23,24)/t12-/m0/s1 |
| InChIKey | AMOWBTZSDREVRB-LBPRGKRZSA-N |
| XLogP | 4.34 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.81 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |