C23H24ClFN4O4 — CID 91214199
2-[2-[4-(3-chloro-4-fluoroanilino)-6-(oxan-4-yloxy)quinazolin-7-yl]oxyethylamino]acetaldehyde (PubChem CID 91214199) has the molecular formula C23H24ClFN4O4 and a molecular weight of 474.92 g/mol. Its IUPAC name is 2-[2-[4-(3-chloro-4-fluoroanilino)-6-(oxan-4-yloxy)quinazolin-7-yl]oxyethylamino]acetaldehyde.
| Compound Name | 2-[2-[4-(3-chloro-4-fluoroanilino)-6-(oxan-4-yloxy)quinazolin-7-yl]oxyethylamino]acetaldehyde |
|---|---|
| PubChem CID | 91214199 |
| Molecular Formula | C23H24ClFN4O4 |
| Molecular Weight | 474.92 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 2-[2-[4-(3-chloro-4-fluoroanilino)-6-(oxan-4-yloxy)quinazolin-7-yl]oxyethylamino]acetaldehyde |
| SMILES | O=CCNCCOc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OC1CCOCC1 |
| InChI | InChI=1S/C23H24ClFN4O4/c24-18-11-15(1-2-19(18)25)29-23-17-12-22(33-16-3-8-31-9-4-16)21(13-20(17)27-14-28-23)32-10-6-26-5-7-30/h1-2,7,11-14,16,26H,3-6,8-10H2,(H,27,28,29) |
| InChIKey | MYEZIOMWIGFIKZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.92 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|