C21H20BrClFN3O3 — CID 18762794
6-(2-bromoethoxy)-N-(3-chloro-4-fluorophenyl)-7-(oxolan-2-ylmethoxy)quinazolin-4-amine (PubChem CID 18762794) has the molecular formula C21H20BrClFN3O3 and a molecular weight of 496.76 g/mol. Its IUPAC name is 6-(2-bromoethoxy)-N-(3-chloro-4-fluorophenyl)-7-(oxolan-2-ylmethoxy)quinazolin-4-amine.
| Compound Name | 6-(2-bromoethoxy)-N-(3-chloro-4-fluorophenyl)-7-(oxolan-2-ylmethoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 18762794 |
| Molecular Formula | C21H20BrClFN3O3 |
| Molecular Weight | 496.76 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | 6-(2-bromoethoxy)-N-(3-chloro-4-fluorophenyl)-7-(oxolan-2-ylmethoxy)quinazolin-4-amine |
| SMILES | Fc1ccc(Nc2ncnc3cc(OCC4CCCO4)c(OCCBr)cc23)cc1Cl |
| InChI | InChI=1S/C21H20BrClFN3O3/c22-5-7-29-19-9-15-18(10-20(19)30-11-14-2-1-6-28-14)25-12-26-21(15)27-13-3-4-17(24)16(23)8-13/h3-4,8-10,12,14H,1-2,5-7,11H2,(H,25,26,27) |
| InChIKey | OBJHEYKUCPTWEH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.76 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|