C21H20ClFN4O — CID 66634926
7-(6-bicyclo[3.1.0]hexanylmethoxy)-4-N-(3-chloro-4-fluorophenyl)quinazoline-4,6-diamine (PubChem CID 66634926) has the molecular formula C21H20ClFN4O and a molecular weight of 398.87 g/mol. Its IUPAC name is 7-(6-bicyclo[3.1.0]hexanylmethoxy)-4-N-(3-chloro-4-fluorophenyl)quinazoline-4,6-diamine.
| Compound Name | 7-(6-bicyclo[3.1.0]hexanylmethoxy)-4-N-(3-chloro-4-fluorophenyl)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 66634926 |
| Molecular Formula | C21H20ClFN4O |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 7-(6-bicyclo[3.1.0]hexanylmethoxy)-4-N-(3-chloro-4-fluorophenyl)quinazoline-4,6-diamine |
| SMILES | Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCC1C2CCCC21 |
| InChI | InChI=1S/C21H20ClFN4O/c22-16-6-11(4-5-17(16)23)27-21-14-7-18(24)20(8-19(14)25-10-26-21)28-9-15-12-2-1-3-13(12)15/h4-8,10,12-13,15H,1-3,9,24H2,(H,25,26,27) |
| InChIKey | VDHWNKYHODPPFW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|