C16H13ClF2N4O — CID 87059147
4-N-(3-chloro-4-fluorophenyl)-7-(2-fluoroethoxy)quinazoline-4,6-diamine (PubChem CID 87059147) has the molecular formula C16H13ClF2N4O and a molecular weight of 350.76 g/mol. Its IUPAC name is 4-N-(3-chloro-4-fluorophenyl)-7-(2-fluoroethoxy)quinazoline-4,6-diamine.
| Compound Name | 4-N-(3-chloro-4-fluorophenyl)-7-(2-fluoroethoxy)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 87059147 |
| Molecular Formula | C16H13ClF2N4O |
| Molecular Weight | 350.76 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 4-N-(3-chloro-4-fluorophenyl)-7-(2-fluoroethoxy)quinazoline-4,6-diamine |
| SMILES | Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCCF |
| InChI | InChI=1S/C16H13ClF2N4O/c17-11-5-9(1-2-12(11)19)23-16-10-6-13(20)15(24-4-3-18)7-14(10)21-8-22-16/h1-2,5-8H,3-4,20H2,(H,21,22,23) |
| InChIKey | GLYRQXVJDRLSFS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.76 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|