C15H9ClF4N4O — CID 66584139
4-N-(3-chloro-4-fluorophenyl)-7-(trifluoromethoxy)quinazoline-4,6-diamine (PubChem CID 66584139) has the molecular formula C15H9ClF4N4O and a molecular weight of 372.71 g/mol. Its IUPAC name is 4-N-(3-chloro-4-fluorophenyl)-7-(trifluoromethoxy)quinazoline-4,6-diamine.
| Compound Name | 4-N-(3-chloro-4-fluorophenyl)-7-(trifluoromethoxy)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 66584139 |
| Molecular Formula | C15H9ClF4N4O |
| Molecular Weight | 372.71 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 4-N-(3-chloro-4-fluorophenyl)-7-(trifluoromethoxy)quinazoline-4,6-diamine |
| SMILES | Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OC(F)(F)F |
| InChI | InChI=1S/C15H9ClF4N4O/c16-9-3-7(1-2-10(9)17)24-14-8-4-11(21)13(25-15(18,19)20)5-12(8)22-6-23-14/h1-6H,21H2,(H,22,23,24) |
| InChIKey | HSIKPDCFQFTVHT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.71 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|